Home
Products
Sinapyl alcohol
| Product Name | Sinapyl alcohol |
| Price: | Inquiry |
| Catalog No.: | CN06748 |
| CAS No.: | 537-33-7 |
| Molecular Formula: | C11H14O4 |
| Molecular Weight: | 210.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The leaves of Platycladus orientalis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC/C=C/c1cc(OC)c(c(c1)OC)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.205g/cm3 |
| Boiling Point | 384.7ºC at 760mmHg |
| Flash Point | 186.4ºC |
| Exact Mass | 210.08900 |
| PSA | 58.92000 |
| LogP | 1.41490 |
| Storage condition | 2-8°C |