Home
Products
Luteolin-3-O-beta-D-glucuronide
| Product Name | Luteolin-3-O-beta-D-glucuronide |
| Price: | Inquiry |
| Catalog No.: | CN04825 |
| CAS No.: | 53527-42-7 |
| Molecular Formula: | C21H18O12 |
| Molecular Weight: | 462.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Rosmarinus officinalis |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | Oc1cc(O)c2c(c1)oc(cc2=O)c1ccc(c(c1)O[C@@H]1O[C@H](C(=O)O)[C@H]([C@@H]([C@H]1O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Luteolin-3-O-beta-D-glucuronide is a luteolin glucosiduronic acid consisting of luteolin having a beta-D-glucosiduronic acid residue attached at the 3'-position. |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 865.4±65.0 °C at 760 mmHg |
| Flash Point | 305.9±27.8 °C |
| Exact Mass | 462.079834 |
| LogP | -1.16 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8℃ |