Home
Products
Marein
| Product Name | Marein |
| Price: | $336 / 10mg |
| Catalog No.: | CN05634 |
| CAS No.: | 535-96-6 |
| Molecular Formula: | C21H22O11 |
| Molecular Weight: | 450.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Chalcones |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Coreopsis maritima |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2ccc(c(c2O)O)C(=O)/C=C/c2ccc(c(c2)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Marein has the neuroprotective effect due to a reduction of damage to mitochondria function and activation of the AMPK signal pathway. Marein improves insulin resistance induced by high glucose in HepG2 cells through CaMKK/AMPK/GLUT1 to promote glucose uptake, through IRS/Akt/GSK-3β to increase glycogen synthesis, and through Akt/FoxO1 to decrease gluconeogenesis. Marein is a HDAC inhibitor with an IC50 of 100 µM. Marein has beneficial antioxidative, antihypertensive, antihyperlipidemic and antidiabetic effects[1][2][3]. |
| Target | IC50: 100 µM (HDAC)[3] |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 835.4±65.0 °C at 760 mmHg |
| Flash Point | 293.5±27.8 °C |
| Exact Mass | 450.116211 |
| PSA | 197.37000 |
| LogP | -0.18 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |