Home
Products
Vaccarin
| Product Name | Vaccarin |
| Price: | $46 / 20mg |
| Catalog No.: | CN05282 |
| CAS No.: | 53452-16-7 |
| Molecular Formula: | C32H38O19 |
| Molecular Weight: | 726.64 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The seeds of Vaccaria segetalis. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@H]([C@@H]([C@H]([C@@H]1O)O)O[C@@H]1OC[C@@H]([C@@H]([C@H]1O)O)O)c1c(O)cc2c(c1O)c(=O)cc(o2)c1ccc(cc1)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Vaccarin is an active flavonoid glycoside associated with various biological functions. Vaccarin significantly promote wound healing and endothelial cells and fibroblasts proliferation in the wound site. Vaccarin ameliorates insulin resistance and steatosis by activating the AMPK signaling pathway[1][2]. |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 1088.1±65.0 °C at 760 mmHg |
| Flash Point | 345.6±27.8 °C |
| Exact Mass | 726.200745 |
| PSA | 319.12000 |
| LogP | -0.74 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |