Home
Products
Linaroside
| Product Name | Linaroside |
| Price: | $380 / 5mg |
| Catalog No.: | CN04272 |
| CAS No.: | 53452-12-3 |
| Molecular Formula: | C23H24O11 |
| Molecular Weight: | 476.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Linaria vulgaris |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(Oc2cc3oc(cc(=O)c3c(c2OC)O)c2ccc(cc2)OC)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Linaroside is a flavonoid, that can be isolated from Lantana camara[1]. |
| Exact Mass | 476.13200 |
| PSA | 168.28000 |
| LogP | 0.36150 |
| Storage condition | 2-8℃ |