Home
Products
Isovitexin 2''-O-arabinoside
| Product Name | Isovitexin 2''-O-arabinoside |
| Price: | $439 / 5mg |
| Catalog No.: | CN04633 |
| CAS No.: | 53382-71-1 |
| Molecular Formula: | C26H28O14 |
| Molecular Weight: | 564.49 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The leaves of Secale cereale. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(C(C(C1O)O)OC1OCC(C(C1O)O)O)c1c(O)cc2c(c1O)c(=O)cc(o2)c1ccc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isovitexin 2''-O-arabinoside is an inactive flavonoid in plantlets of Avena sativa L. (Poaceae)[1]. |
| Density | 1.79±0.1 g/cm3(Predicted) |
| Boiling Point | 941.5±65.0 °C(Predicted) |