Home
Products
5,7,3',4',5'-Pentamethoxyflavone
| Product Name | 5,7,3',4',5'-Pentamethoxyflavone |
| Price: | $146 / 10mg |
| Catalog No.: | CN04454 |
| CAS No.: | 53350-26-8 |
| Molecular Formula: | C20H20O7 |
| Molecular Weight: | 372.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Camellia sinensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(OC)c2c(c1)oc(cc2=O)c1cc(OC)c(c(c1)OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3',4',5',5,7-Pentamethoxyflavone, a natural flavonoid extracted from Rutaceae plants, sensitizes chemoresistant cancer cells to chemotherapeutic drugs by inhibition of Nrf2 pathway[1]. |
| Density | 1.244g/cm3 |
| Boiling Point | 554.4ºC at 760mmHg |
| Flash Point | 243.5ºC |
| Exact Mass | 372.12100 |
| PSA | 76.36000 |
| LogP | 3.50300 |
| Storage condition | 2-8°C |