Home
Products
2''-O-Galloylhyperin
| Product Name | 2''-O-Galloylhyperin |
| Price: | $117 / 20mg |
| Catalog No.: | CN05501 |
| CAS No.: | 53209-27-1 |
| Molecular Formula: | C28H24O16 |
| Molecular Weight: | 616.48 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Hypericum perforatum L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@@H]1O[C@H](Oc2c(oc3c(c2=O)c(O)cc(c3)O)c2ccc(c(c2)O)O)[C@H]([C@@H]([C@@H]1O)O)OC(=O)c1cc(O)c(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 2"-O-Galloylhyperin, an active compound isolated from Pyrola incarnate Fisch., possesses anti-oxidative and anti-inflammatory activities. 2"-O-Galloylhyperin has hepatoprotective effect against oxidative stress-induced liver damage[1][2]. |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 1106.9±65.0 °C at 760 mmHg |
| Flash Point | 365.6±27.8 °C |
| Exact Mass | 616.106445 |
| PSA | 277.27000 |
| LogP | 3.61 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8C |