Home
Products
Scopolin
| Product Name | Scopolin |
| Price: | $71 / 20mg |
| Catalog No.: | CN06247 |
| CAS No.: | 531-44-2 |
| Molecular Formula: | C16H18O9 |
| Molecular Weight: | 354.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The herbs of Scopolia japonica. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc3oc(=O)ccc3cc2OC)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Scopolin is a coumarin isolated from Arabidopsis thaliana (Arabidopsis) roots[1]. Scopolin attenuated hepatic steatosis through activation of SIRT1-mediated signaling cascades[2]. |
| Target | SIRT1 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 650.2±55.0 °C at 760 mmHg |
| Flash Point | 241.5±25.0 °C |
| Exact Mass | 354.095093 |
| PSA | 138.82000 |
| LogP | -1.87 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |