Home
Products
Coniferin
| Product Name | Coniferin |
| Price: | $204 / 20mg |
| Catalog No.: | CN06952 |
| CAS No.: | 531-29-3 |
| Molecular Formula: | C16H22O8 |
| Molecular Weight: | 342.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Acanthopanax gracilistylus. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC/C=C/c1ccc(c(c1)OC)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Coniferin (Laricin) is a glucoside of coniferyl alcohol. Coniferin inhibits fungal growth and melanization[1]. |
| Target | Fungal[1] |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 625.4±55.0 °C at 760 mmHg |
| Flash Point | 332.0±31.5 °C |
| Exact Mass | 342.131470 |
| PSA | 128.84000 |
| LogP | -1.51 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Storage condition | ?20°C |