Home
Products
Androsin
| Product Name | Androsin |
| Price: | $173 / 10mg |
| Catalog No.: | CN03742 |
| CAS No.: | 531-28-2 |
| Molecular Formula: | C15H20O8 |
| Molecular Weight: | 328.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The herbs of Nerium indicum Mill. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2ccc(cc2OC)C(=O)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Androsin is an active compound isolated from Picrorhiza Kurroa Royle ex Benth, with anti-asthmatic effects[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 568.3±50.0 °C at 760 mmHg |
| Flash Point | 210.6±23.6 °C |
| Exact Mass | 328.115814 |
| PSA | 125.68000 |
| LogP | -1.09 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |