Home
Products
Morellic acid
| Product Name | Morellic acid |
| Price: | $467 / 10mg |
| Catalog No.: | CN06583 |
| CAS No.: | 5304-71-2 |
| Molecular Formula: | C33H36O8 |
| Molecular Weight: | 560.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The herbs of Garcinia Morella |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCc1c2O[C@]34C(=C[C@@H]5C[C@H]3C(O[C@@]4(C/C=C(C(=O)O)/C)C5=O)(C)C)C(=O)c2c(c2c1OC(C)(C)C=C2)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Morellic acid is isolated from Garcinia Morella with an antiangiogenic activity[1]. |
| Target | IC50: antiangiogenic[1] |
| In Vitro | Morellic acid inhibits the migration of HUVEC at a low concentration of 0.5 µM in HUVEC cell migration assay in vitro[1]. |
| Density | 1.36±0.1 g/cm3(Predicted) |
| Boiling Point | 777.6±60.0 °C(Predicted) |
| Exact Mass | 453.24200 |
| PSA | 37.30000 |
| LogP | 4.85080 |