Home
Products
N-Formylcytisine
| Product Name | N-Formylcytisine |
| Price: | $380 / 10mg |
| Catalog No.: | CN00098 |
| CAS No.: | 53007-06-0 |
| Molecular Formula: | C12H14N2O2 |
| Molecular Weight: | 218.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Thermopsis chinensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=CN1C[C@@H]2C[C@H](C1)c1n(C2)c(=O)ccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | N-Formylcytisine is a cytisine-type alkaloid from the stem bark of Maackia amurensis[1]. |
| Density | 1.31±0.1 g/cm3(Predicted) |
| Boiling Point | 512.8±49.0 °C(Predicted) |
| Exact Mass | 218.10600 |
| PSA | 42.31000 |
| LogP | 0.99760 |