Home
Products
Picein
| Product Name | Picein |
| Price: | Inquiry |
| Catalog No.: | CN03325 |
| CAS No.: | 530-14-3 |
| Molecular Formula: | C14H18O7 |
| Molecular Weight: | 298.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The herbs of Nerium indicum Mill. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2ccc(cc2)C(=O)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Picein, isolated from Picrorhiza kurroa, is a naturally occurring antioxidant[1]. |
| Density | 1.433 g/cm3 |
| Boiling Point | 562.6ºC at 760 mmHg |
| Flash Point | 213.2ºC |
| Exact Mass | 298.10500 |
| PSA | 116.45000 |
| Storage condition | Hygroscopic, -20?C Freezer, Under Inert Atmosphere |