Home
Products
Ajugol
| Product Name | Ajugol |
| Price: | $98 / 20mg |
| Catalog No.: | CN03086 |
| CAS No.: | 52949-83-4 |
| Molecular Formula: | C15H24O9 |
| Molecular Weight: | 348.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The roots of Rehmannia glutinosa. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@@H]2OC=C[C@@H]3[C@H]2[C@@](C)(O)C[C@H]3O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ajugol is an iridiod glucoside. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 582.3±50.0 °C at 760 mmHg |
| Flash Point | 305.9±30.1 °C |
| Exact Mass | 348.142029 |
| PSA | 149.07000 |
| LogP | 1.30 |
| Vapour Pressure | 0.0±3.7 mmHg at 25°C |
| Storage condition | -20°C |