Home
Products
Caulophyllogenin
| Product Name | Caulophyllogenin |
| Price: | $483 / 10mg |
| Catalog No.: | CN07209 |
| CAS No.: | 52936-64-8 |
| Molecular Formula: | C30H48O5 |
| Molecular Weight: | 488.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Caulophyllum robustum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@]1(C)[C@@H](O)CC[C@]2([C@H]1CC[C@@]1([C@@H]2CC=C2[C@@]1(C)C[C@@H](O)[C@@]1([C@H]2CC(CC1)(C)C)C(=O)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Caulophyllogenin is a triterpene saponin extracted from M. polimorpha. Caulophyllogenin is a partial PPARγ agonist, with an EC50 of 12.6 μM. Caulophyllogenin can be used for the research of type-2 diabetes, obesity, metabolic syndrome and inflammation[1][2]. |
| Target | PPARγ:12.6 μM (EC50) |
| Density | 1.19g/cm3 |
| Boiling Point | 621.5ºC at 760mmHg |
| Flash Point | 343.7ºC |
| Exact Mass | 488.35000 |
| PSA | 97.99000 |
| LogP | 5.17680 |
| Storage condition | 2-8°C |