Home
Products
Scutellarein
| Product Name | Scutellarein |
| Price: | $46 / 20mg |
| Catalog No.: | CN05380 |
| CAS No.: | 529-53-3 |
| Molecular Formula: | C15H10O6 |
| Molecular Weight: | 286.24 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Scutellaria baicalensis Georgi |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc(cc1)c1cc(=O)c2c(o1)cc(c(c2O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Scutellarin, a main active ingredient extracted from Erigeron breviscapus (Vant.) Hand-Mazz., has been wildly used to treat acute cerebral infarction and paralysis induced by cerebrovascular diseases. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 642.9±55.0 °C at 760 mmHg |
| Flash Point | 249.9±25.0 °C |
| Exact Mass | 286.047729 |
| PSA | 111.13000 |
| LogP | 2.54 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Storage condition | 2-8°C |