Home
Products
Gentisein
| Product Name | Gentisein |
| Price: | Inquiry |
| Catalog No.: | CN05791 |
| CAS No.: | 529-49-7 |
| Molecular Formula: | C13H8O5 |
| Molecular Weight: | 244.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Xanthones |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Calophyllum inophyllum L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1cc(O)c2c(c1)oc1c(c2=O)cc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Gentisein (NSC 329491), the major metabolite of Mangiferin, shows the most potent serotonin uptake inhibition with an IC50 value of 4.7 µM[1][2]. |
| Exact Mass | 244.03700 |
| PSA | 90.90000 |
| LogP | 2.06300 |