Home
Products
20-Hydroxyecdysone
| Product Name | 20-Hydroxyecdysone |
| Price: | $28 / 20mg |
| Catalog No.: | CN02507 |
| CAS No.: | 5289-74-7 |
| Molecular Formula: | C27H44O7 |
| Molecular Weight: | 480.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The roots of Cyanotis arachnoidea C. B. Clarke. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@H]1C[C@@]2(C)[C@@H](C[C@H]1O)C(=O)C=C1[C@@H]2CC[C@]2([C@@]1(O)CC[C@@H]2[C@]([C@@H](CCC(O)(C)C)O)(O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Crustecdysone (20-Hydroxyecdysone) is a naturally occurring ecdysteroid hormone isolated from Cyanotis arachnoides C.B.Clarke which controls the ecdysis (moulting) and metamorphosis of arthropods, it inhibits caspase activity and induces autophagy via the 20E nuclear receptor complex, EcR-USP[1].Crustecdysone exhibits regulatory or protective roles in the cardiovascular system[2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 702.1±60.0 °C at 760 mmHg |
| Flash Point | 392.4±29.4 °C |
| Exact Mass | 480.308716 |
| PSA | 138.45000 |
| LogP | -0.53 |
| Vapour Pressure | 0.0±5.0 mmHg at 25°C |
| Storage condition | 2-8°C |