Home
Products
Delphinidin chloride
| Product Name | Delphinidin chloride |
| Price: | $366 / 5mg |
| Catalog No.: | CN05138 |
| CAS No.: | 528-53-0 |
| Molecular Formula: | C15H11ClO7 |
| Molecular Weight: | 338.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Vaccinium myrtillus |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | Oc1cc(O)c2c(c1)[o+]c(c(c2)O)c1cc(O)c(c(c1)O)O.[Cl-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Delphinidin chloride, an anthocyanidin, is isolated from berries and red wine. Delphinidin chloride shows endothelium-dependent vasorelaxation. Delphinidin chloride also can modulate JAK/STAT3 and MAPKinase signaling to induce apoptosis in HCT116 cells[1][2][3]. |
| Density | 1.3946 (rough estimate) |
| Boiling Point | 454.94°C (rough estimate) |
| Exact Mass | 338.019318 |
| PSA | 134.52000 |
| Storage condition | −20°C |