Home
Products
Herbacetin
| Product Name | Herbacetin |
| Price: | $161 / 10mg |
| Catalog No.: | CN05480 |
| CAS No.: | 527-95-7 |
| Molecular Formula: | C15H10O7 |
| Molecular Weight: | 302.24 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Equisetum hyemale L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc(cc1)c1oc2c(O)c(O)cc(c2c(=O)c1O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Herbacetin is a natural flavonoid from flaxseed, exerts various pharmacological activities, including antioxidant, anti-inflammatory and anticancer effects[1]. Herbacetin is an Ornithine decarboxylase (ODC) allosteric inhibitor, directly binds to Asp44, Asp243, and Glu384 on ODC. Ornithine decarboxylase (ODC) is a rate-limiting enzyme in the first step of polyamine biosynthesis[2]. |
| Target | IC50: Ornithine decarboxylase[2] |
| In Vivo | Herbacetin (orally administration; 20mg/kg) significantly reduces the body weight, plasma glucose, plasma insulin, and HOMA-IR activity in obesity associated insulin resistant mice (OIR). (Herbacetin dissolves in 0.5% DMSO)[1]. Herbacetin (intraperitoneal injection; 0.4, 2, 10 or 20 mg/kg; B.W.) decreases the number and size of polyps in APCMin+ mice with no overt toxicity[2]. |
| Density | 1.799 |
| Boiling Point | 618.7±55.0 °C at 760 mmHg |
| Flash Point | 239.0±25.0 °C |
| Exact Mass | 302.042664 |
| PSA | 131.36000 |
| LogP | 1.14 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |