Home
Products
Kirenol
| Product Name | Kirenol |
| Price: | $62 / 20mg |
| Catalog No.: | CN08814 |
| CAS No.: | 52659-56-0 |
| Molecular Formula: | C20H34O4 |
| Molecular Weight: | 338.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Siegesbeckia orientalis. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@@H]([C@@]1(C)CC[C@@H]2C(=C1)CC[C@H]1[C@@]2(C)C[C@H](O)C[C@@]1(C)CO)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Kirenol is isolated from Siegesbeckia orientalis with anti-inflammatory and analgesic activity[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 516.9±35.0 °C at 760 mmHg |
| Flash Point | 233.6±20.5 °C |
| Exact Mass | 338.245697 |
| PSA | 80.92000 |
| LogP | 1.78 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |