Home
Products
Ponicidin
| Product Name | Ponicidin |
| Price: | $277 / 10mg |
| Catalog No.: | CN08605 |
| CAS No.: | 52617-37-5 |
| Molecular Formula: | C20H26O6 |
| Molecular Weight: | 362.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Cryst. |
| Source: | The herbs of Isodon japonicus |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | C=C1C2CC[C@@H]3[C@]4(C1=O)[C@H]2O[C@@H]1[C@@]23[C@@H](O)CCC([C@H]2[C@@H]([C@@]4(O)O1)O)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ponicidin (Rubescensine B) is a diterpenoid derived from Rabdosia rubescens, and exhibits immunoregulatory, anti-inflammatory, anti-viral and anti-cancer activity. Ponicidin (Rubescensine B) induces apoptosis of gastric carcinoma cell, decreases the phosphorylation of JAK2 and STAT3, and shows no effect on protein levels of JAK2 and STAT3[1]. |
| Target | Apoptosis[1] |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 580.9±50.0 °C at 760 mmHg |
| Flash Point | 210.0±23.6 °C |
| Exact Mass | 362.172943 |
| PSA | 96.22000 |
| LogP | 3.11 |
| Vapour Pressure | 0.0±3.7 mmHg at 25°C |
| Storage condition | 2-8℃ |