Home
Products
Deacetylasperulosidic acid methyl ester
| Product Name | Deacetylasperulosidic acid methyl ester |
| Price: | $77 / 20mg |
| Catalog No.: | CN03103 |
| CAS No.: | 52613-28-2 |
| Molecular Formula: | C17H24O11 |
| Molecular Weight: | 404.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Hedyotis diffusa Willd. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1=C[C@@H]([C@H]2[C@@H]1[C@@H](OC=C2C(=O)OC)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Methyl deacetylasperulosidate is an iridoid isolated from Borreria and Spermacoce species. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 696.3±55.0 °C at 760 mmHg |
| Flash Point | 250.9±25.0 °C |
| Exact Mass | 404.131866 |
| PSA | 175.37000 |
| LogP | -2.72 |
| Vapour Pressure | 0.0±5.0 mmHg at 25°C |
| Storage condition | 2-8°C |