Home
Products
Sesamolin
| Product Name | Sesamolin |
| Price: | $65 / 10mg |
| Catalog No.: | CN02972 |
| CAS No.: | 526-07-8 |
| Molecular Formula: | C20H18O7 |
| Molecular Weight: | 370.36 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | White powder |
| Source: | The herbs of Justicia orbiculata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C1Oc2c(O1)cc(cc2)O[C@H]1OC[C@H]2[C@@H]1CO[C@@H]2c1ccc2c(c1)OCO2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sesaminol, isolated from Justicia orbiculata, has antioxidative activity, Sesaminol inhibits lipid peroxidation and shows neuroprotection effect. Sesaminol potently inhibits MAPK cascades by preventing phosphorylation of JNK, p38 MAPKs, and caspase-3 but not ERK-MAPK expression[1][2][3][4]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 520.8±50.0 °C at 760 mmHg |
| Flash Point | 219.2±30.0 °C |
| Exact Mass | 370.105255 |
| PSA | 64.61000 |
| LogP | 2.88 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |