Home
Products
1-Cinnamoylpyrrolidine
| Product Name | 1-Cinnamoylpyrrolidine |
| Price: | $439 / 10mg |
| Catalog No.: | CN01045 |
| CAS No.: | 52438-21-8 |
| Molecular Formula: | C13H15NO |
| Molecular Weight: | 201.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Piper nigrum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(N1CCCC1)/C=C/c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 1-Cinnamoylpyrrolidine (Compound 3), a crude extract prepared from Piper caninum, is a DNA strand scission agent, induces the relaxation of supercoiled pBR322 plasmid DNA[1].1-Cinnamoylpyrrolidine (Compound 4) inhibits platelet aggregation induced by PAF with an IC50 of 37.3 μM[2]. |
| Target | IC50: 37.3 μM (1-Cinnamoylpyrrolidine)[2] |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 386.0±12.0 °C at 760 mmHg |
| Flash Point | 184.4±10.8 °C |
| Exact Mass | 201.115356 |
| LogP | 2.18 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |