Home
Products
Isobutylshikonin
| Product Name | Isobutylshikonin |
| Price: | $263 / 10mg |
| Catalog No.: | CN05893 |
| CAS No.: | 52438-12-7 |
| Molecular Formula: | C20H22O6 |
| Molecular Weight: | 358.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Quinones |
| Physical Desc.: | Powder |
| Source: | The roots of Lithosperraum erythrorhizon Sieb. et Zucc. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CC[C@H](C1=CC(=O)c2c(C1=O)c(O)ccc2O)OC(=O)C(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isobutylshikonin is a kind of shikonin pigments from hairy root culture of Lithospermum canescens[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 565.2±45.0 °C at 760 mmHg |
| Flash Point | 295.6±28.7 °C |
| Exact Mass | 358.141632 |
| PSA | 100.90000 |
| LogP | 4.27 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |