Home
Products
Noricaritin
| Product Name | Noricaritin |
| Price: | $219 / 10mg |
| Catalog No.: | CN05393 |
| CAS No.: | 5240-95-9 |
| Molecular Formula: | C20H20O7 |
| Molecular Weight: | 372.37 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The roots of Epimedium brevicornu Maxim |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc(cc1)c1oc2c(CCC(O)(C)C)c(O)cc(c2c(=O)c1O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Noricaritin is a flavonoid sourced from roots of Epimedium brevicornu Maxim. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 650.2±55.0 °C at 760 mmHg |
| Flash Point | 234.1±25.0 °C |
| Exact Mass | 372.120911 |
| PSA | 131.36000 |
| LogP | 2.41 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Storage condition | 2-8C |