Home
Products
Armepavine
| Product Name | Armepavine |
| Price: | $176 / 5mg |
| Catalog No.: | CN00726 |
| CAS No.: | 524-20-9 |
| Molecular Formula: | C19H23NO3 |
| Molecular Weight: | 313.39 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Nelumbo nucifera |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2c(cc1OC)CCN([C@@H]2Cc1ccc(cc1)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Armepavine, an active compound from Nelumbo nucifera, exerts not only anti-inflammatory effects on human peripheral blood mononuclear cells, but also immunosuppressive effects on T lymphocytes and on lupus nephritic mice. Armepavine inhibits TNF-α-induced MAPK and NF-κB signaling cascades[1]. |
| Target | p65 |
| Density | 1.151g/cm3 |
| Boiling Point | 460.5ºC at 760 mmHg |
| Flash Point | 232.3ºC |
| Exact Mass | 313.16800 |
| PSA | 41.93000 |
| LogP | 3.11900 |