Home
Products
Dauricine
| Product Name | Dauricine |
| Price: | $62 / 20mg |
| Catalog No.: | CN02088 |
| CAS No.: | 524-17-4 |
| Molecular Formula: | C38H44N2O6 |
| Molecular Weight: | 624.77 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Menispermum dauricum DC |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2c(cc1OC)CCN([C@@H]2Cc1ccc(cc1)Oc1cc(ccc1O)C[C@H]1N(C)CCc2c1cc(OC)c(c2)OC)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dauricine, a bisbenzylisoquinoline alkaloid in Asiatic Moonseed Rhizome, possesses anti-inflammatory activity. Dauricine inhibits cell proliferation and invasion, and induces apoptosis by suppressing NF-κB activation in a dose- and time-dependent manner in colon cancer[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 712.3±60.0 °C at 760 mmHg |
| Flash Point | 384.6±32.9 °C |
| Exact Mass | 624.319946 |
| PSA | 72.86000 |
| LogP | 6.61 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Storage condition | 2-8 °C |