Home
Products
Wedelolactone
| Product Name | Wedelolactone |
| Price: | $103 / 20mg |
| Catalog No.: | CN06250 |
| CAS No.: | 524-12-9 |
| Molecular Formula: | C16H10O7 |
| Molecular Weight: | 314.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Eclipta prostrata. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)c2c(c1)oc(=O)c1c2oc2c1cc(c(c2)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Wedelolactone, a natural product from Ecliptae herba, suppresses LPS-induced caspase-11 expression by directly inhibiting the IKK Complex[1]. Wedelolactone inhibits 5-lipoxygenase (5-Lox) (IC50~2.5 μM) activity by an oxygen radical scavenging mechanism. Wedelolactone induces caspase-dependent apoptosis in prostate cancer cells via downregulation of PKCε without inhibiting Akt[2]. Anti-cancer, anti-inflammatory, and antioxidant activities[3]. |
| Target | Caspase-11 5-lipoxygenase:2.5 μM (IC50) Apoptosis |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 498.4±45.0 °C at 760 mmHg |
| Flash Point | 255.2±28.7 °C |
| Exact Mass | 314.042664 |
| PSA | 113.27000 |
| LogP | 2.75 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Storage condition | 2-8°C |