Home
Products
Apioline
| Product Name | Apioline |
| Price: | Inquiry |
| Catalog No.: | CN03315 |
| CAS No.: | 523-80-8 |
| Molecular Formula: | C12H14O4 |
| Molecular Weight: | 222.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Oil |
| Source: | The herbs of Apium graveolens |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=CCc1cc(OC)c2c(c1OC)OCO2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.151g/cm3 |
| Boiling Point | 294ºC |
| Flash Point | 117.2ºC |
| Exact Mass | 222.08900 |
| PSA | 36.92000 |
| LogP | 2.16100 |