Home
Products
Isomucronulatol
| Product Name | Isomucronulatol |
| Price: | $307 / 10mg |
| Catalog No.: | CN04808 |
| CAS No.: | 52250-35-8 |
| Molecular Formula: | C17H18O5 |
| Molecular Weight: | 302.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Astragalus membranaceus |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(OC)ccc(c1O)C1COc2c(C1)ccc(c2)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isomucronulatol is a flavonoid isolated from the roots of A. membranaceus. Isomucronulatol exhibits inhibitory effects on LPS-stimulated production IL-12 p40 in vitro and has potential anti-inflammatory effect[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 426.8±45.0 °C at 760 mmHg |
| Flash Point | 211.9±28.7 °C |
| Exact Mass | 302.115417 |
| PSA | 68.15000 |
| LogP | 2.63 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |