Home
Products
Tetrahydroberberine
| Product Name | Tetrahydroberberine |
| Price: | $46 / 20mg |
| Catalog No.: | CN01221 |
| CAS No.: | 522-97-4 |
| Molecular Formula: | C20H21O4N |
| Molecular Weight: | 339.38 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Cryst. |
| Source: | The barks of Phellodendron chinense Schneid. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(OC)ccc2c1CN1CCc3c(C1C2)cc1c(c3)OCO1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tetrahydroberberine is an isoquinoline alkaloid isolated from corydalis tuber; has micromolar affinity for dopamine D(2) (pK(i) = 6.08) and 5-HT(1A) (pK(i) = 5.38) receptors but moderate to no affinity for other relevant serotonin receptors (5-HT(1B), 5-HT(1D), 5-HT(3), and 5-HT(4); pK(i) < 5.00). |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 476.1±45.0 °C at 760 mmHg |
| Flash Point | 141.1±25.9 °C |
| Exact Mass | 339.147064 |
| PSA | 40.16000 |
| LogP | 3.83 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Storage condition | 2-8°C |