Home
Products
Dihydroquinine
| Product Name | Dihydroquinine |
| Price: | Inquiry |
| Catalog No.: | CN00682 |
| CAS No.: | 522-66-7 |
| Molecular Formula: | C20H26N2O2 |
| Molecular Weight: | 326.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC[C@H]1CN2CC[C@H]1C[C@H]2[C@@H](c1ccnc2c1cc(OC)cc2)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Hydroquinone is a inhibitor of melanin synthesis, serves as a skin whitener and is usually available in cosmetics or on prescription[1].Hydroquinone can be used in the preparation of oxidized light-emitting materials such as lucigenin by inducing the production of hydrogen peroxide in the presence of basic compounds.Hydroquinone (HQ) is the most abundant quinine present in cigarette tar it can enter the circulation via the lungs and can interact with cellular targets throughout the body, hepatotoxic and nephrotoxic properties has been reported[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 498.4±30.0 °C at 760 mmHg |
| Flash Point | 255.2±24.6 °C |
| Exact Mass | 326.199432 |
| PSA | 45.59000 |
| LogP | 3.77 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Storage condition | 2~8°C |