Home
Products
Karanjin
| Product Name | Karanjin |
| Price: | $190 / 5mg |
| Catalog No.: | CN04521 |
| CAS No.: | 521-88-0 |
| Molecular Formula: | C18H12O4 |
| Molecular Weight: | 292.29 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Pongamia pinnata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(oc2c(c1=O)ccc1c2cco1)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Karanjin is a major active furanoflavonol constituent of Fordia cauliflora. Karanjin induces GLUT4 translocation in skeletal muscle cells by increasing AMPK activity. Karanjin can induce cancer cell death through cell cycle arrest and enhance apoptosis[1][2]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 463.0±45.0 °C at 760 mmHg |
| Flash Point | 233.8±28.7 °C |
| Exact Mass | 292.073547 |
| PSA | 52.58000 |
| LogP | 3.29 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |