Home
Products
Frangulin A
| Product Name | Frangulin A |
| Price: | Inquiry |
| Catalog No.: | CN05924 |
| CAS No.: | 521-62-0 |
| Molecular Formula: | C21H20O9 |
| Molecular Weight: | 416.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Powder |
| Source: | The barks of Rhamnus frangula L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O[C@H]1[C@@H](O[C@@H]([C@@H]([C@H]1O)O)C)Oc1cc(O)c2c(c1)C(=O)c1c(C2=O)c(O)cc(c1)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.597 g/cm3 |
| Boiling Point | 744.3ºC at 760 mmHg |
| Flash Point | 265.9ºC |
| Exact Mass | 416.11100 |
| PSA | 153.75000 |
| LogP | 0.38790 |
| Storage condition | 2-8°C |