Home
Products
Vulpic acid
| Product Name | Vulpic acid |
| Price: | Inquiry |
| Catalog No.: | CN06527 |
| CAS No.: | 521-52-8 |
| Molecular Formula: | C19H14O5 |
| Molecular Weight: | 322.32 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | From lichen metabolites. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC(=O)/C(=C1/OC(=O)C(=C1O)c1ccccc1)/c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Vulpinic acid, a lichen metabolite, decreases H2O2-induced ROS production, oxidative stress and oxidative stress-related damages in human umbilical vein endothelial cells (HUVEC). Vulpinic acid is active against staphylococci, enterococci, and anaerobic bacteria.Vulpinic acid has the potential for atherosclerosis research[1][2]. |
| Density | 1.375g/cm3 |
| Boiling Point | 568.8ºC at 760mmHg |
| Flash Point | 210.2ºC |
| Exact Mass | 322.08400 |
| PSA | 72.83000 |
| LogP | 3.09680 |
| Storage condition | -20°C Freezer |