Home
Products
Bilobetin
| Product Name | Bilobetin |
| Price: | $204 / 10mg |
| Catalog No.: | CN05314 |
| CAS No.: | 521-32-4 |
| Molecular Formula: | C31H20O10 |
| Molecular Weight: | 552.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The leaves of Ginkgo biloba L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1c1c(O)cc(c2c1oc(cc2=O)c1ccc(cc1)O)O)c1cc(=O)c2c(o1)cc(cc2O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Bilobetin, an active component of Ginkgo biloba, can reduce blood lipids and improve the effects of insulin. Bilobetin ameliorated insulin resistance, increased the hepatic uptake and oxidation of lipids, reduced very-low-density lipoprotein triglyceride secretion and blood triglyceride levels, enhanced the expression and activity of enzymes involved in β-oxidation and attenuated the accumulation of triglycerides and their metabolites in tissues. Bilobetin also increased the phosphorylation, nuclear translocation and activity of PPARα accompanied by elevated cAMP level and PKA activity[1]. |
| Target | PPARα PKA |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 869.9±65.0 °C at 760 mmHg |
| Flash Point | 291.9±27.8 °C |
| Exact Mass | 552.105652 |
| PSA | 170.80000 |
| LogP | 4.20 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |