Home
Products
Isoschaftoside
| Product Name | Isoschaftoside |
| Price: | $146 / 10mg |
| Catalog No.: | CN05142 |
| CAS No.: | 52012-29-0 |
| Molecular Formula: | C26H28O14 |
| Molecular Weight: | 564.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Desmodium styracifolium (Osh.) Merr. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(C(C(C1O)O)O)c1c(O)c(C2OCC(C(C2O)O)O)c(c2c1oc(cc2=O)c1ccc(cc1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isoschaftoside, a C-glycosylflavonoid from Desmodium uncinatum root exudate, can inhibit growth of germinated S. hermonthica radicles[1][2]. |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 935.0±65.0 °C at 760 mmHg |
| Flash Point | 314.3±27.8 °C |
| Exact Mass | 564.147888 |
| PSA | 250.97000 |
| LogP | 0.04 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8℃ |