Home
Products
Echimidine
| Product Name | Echimidine |
| Price: | Inquiry |
| Catalog No.: | CN01651 |
| CAS No.: | 520-68-3 |
| Molecular Formula: | C20H31NO7 |
| Molecular Weight: | 397.47 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Oil |
| Source: | The herbs of Echium plantagineum L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C=C(C(=O)O[C@@H]1CCN2[C@@H]1C(=CC2)COC(=O)[C@](C(O)(C)C)([C@@H](O)C)O)/C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Echimidine ((+)-Echimidine) is the major alkaloid detected in the honey used to produce the mead[1]. |
| In Vitro | Echimidine, a major hepatotoxic dehydropyrrolizidine alkaloid produced by E. plantagineum, in the honey (780 ng/g) and in the subsequent mead samples (236-540 ng/mL)[1]. |
| Boiling Point | 535.7±50.0 °C at 760 mmHg |
| Exact Mass | 397.21000 |
| PSA | 116.53000 |
| LogP | 0.24260 |