Home
Products
Tricin
| Product Name | Tricin |
| Price: | $161 / 5mg |
| Catalog No.: | CN05319 |
| CAS No.: | 520-32-1 |
| Molecular Formula: | C17H14O7 |
| Molecular Weight: | 330.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Avena sativa |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(cc(c1O)OC)c1cc(=O)c2c(o1)cc(cc2O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tricin is a natural flavonoid present in large amounts in rice bran. Tricin can inhibit human cytomegalovirus (HCMV) replication by inhibiting CDK9. Tricin inhibits the proliferation and invasion of C6 glioma cells via the upregulation of focal-adhesion-finase (FAK)-targeting microRNA-7[1][2][3]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 598.5±50.0 °C at 760 mmHg |
| Flash Point | 224.0±23.6 °C |
| Exact Mass | 330.073944 |
| PSA | 109.36000 |
| LogP | 1.39 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |