Home
Products
Pectolinarigenin
| Product Name | Pectolinarigenin |
| Price: | $100 / 20mg |
| Catalog No.: | CN05591 |
| CAS No.: | 520-12-7 |
| Molecular Formula: | C17H14O6 |
| Molecular Weight: | 314.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The leaves of Linaria vulgaris Mill |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)c1cc(=O)c2c(o1)cc(c(c2O)OC)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Pectolinarigenin, isolated from Cirsium chanroenicum, is a dual inhibitor of COX-2/5-LOX. Anti-inflammatory activity[1]. Pectolinarigenin has potent inhibitory activities on melanogenesis[2]. |
| Target | COX-2 5-LOX |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 565.5±50.0 °C at 760 mmHg |
| Flash Point | 212.3±23.6 °C |
| Exact Mass | 314.079041 |
| PSA | 89.13000 |
| LogP | 2.64 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Storage condition | 2-8C |