Home
Products
Schaftoside
| Product Name | Schaftoside |
| Price: | $62 / 20mg |
| Catalog No.: | CN05220 |
| CAS No.: | 51938-32-0 |
| Molecular Formula: | C26H28O14 |
| Molecular Weight: | 564.49 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Desmodium styracifolium (Osh.) Merr. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@H]([C@@H]([C@H]([C@@H]1O)O)O)c1c(O)c([C@@H]2OC[C@@H]([C@@H]([C@H]2O)O)O)c2c(c1O)c(=O)cc(o2)c1ccc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Schaftoside is a flavonoid found in a variety of Chinese herbal medicines, such as Eleusine indica. Schaftoside inhibits the expression of TLR4 and Myd88. Schaftoside also decreases Drp1 expression and phosphorylation, and reduces mitochondrial fission[1]. |
| In Vitro | Schaftoside inhibits three pro-inflammatory enzymatic activities: secretory phospholipase A2 (sPLA2), lipoxygenase (LOX), and cyclooxygenase 2 (COX-2). Schaftoside also inhibits mRNA and protein expressions of proinflammatory cytokines(IL-1β, TNF-α, and IL-6)[1]. |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 1028.2±65.0 °C at 760 mmHg |
| Flash Point | 342.7±27.8 °C |
| Exact Mass | 596.137756 |
| PSA | 269.43000 |
| LogP | -3.06 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8°C |