Home
Products
7-O-Methyleriodictyol
| Product Name | 7-O-Methyleriodictyol |
| Price: | Inquiry |
| Catalog No.: | CN05323 |
| CAS No.: | 51857-11-5 |
| Molecular Formula: | C16H14O6 |
| Molecular Weight: | 302.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The branches of Viscum coloratum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2O[C@@H](CC(=O)c2c(c1)O)c1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sternbin is the detoxified metabolites from the rice flavanone phytoalexin Sakuranetin by Pyricularia oryzae. Sakuranetin is a flavanone phytoalexin associated with disease resistance in rice plants[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 607.2±55.0 °C at 760 mmHg |
| Flash Point | 231.3±25.0 °C |
| Exact Mass | 302.079041 |
| PSA | 96.22000 |
| LogP | 2.77 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |