Home
Products
2'-O-Methylisoliquiritigenin
| Product Name | 2'-O-Methylisoliquiritigenin |
| Price: | $307 / 5mg |
| Catalog No.: | CN05679 |
| CAS No.: | 51828-10-5 |
| Molecular Formula: | C16H14O4 |
| Molecular Weight: | 270.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Chalcones |
| Physical Desc.: | Yellow powder |
| Source: | The roots of Glycyrrhiza glabra L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)ccc1C(=O)C=Cc1ccc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 2'-O-Methylisoliquiritigenin, isolated from the Arachis species, up-regulates 5-HT, NE, DA and GABA pathways, but does not put a very significant effect on ne NE pathway[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 527.1±50.0 °C at 760 mmHg |
| Flash Point | 200.5±23.6 °C |
| Exact Mass | 270.089203 |
| PSA | 66.76000 |
| LogP | 2.96 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |