Home
Products
Xanthopurpurin
| Product Name | Xanthopurpurin |
| Price: | $219 / 5mg |
| Catalog No.: | CN05954 |
| CAS No.: | 518-83-2 |
| Molecular Formula: | C14H8O4 |
| Molecular Weight: | 240.21 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Yellow powder |
| Source: | The roots of Rubia cordifolia |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1cc(O)c2c(c1)C(=O)c1c(C2=O)cccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Xanthopurpurin, an anthraquinone glycoside, isolated from the roots of Rubia akane, shows mainly strong inhibition of collagen-induced platelet aggregation[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 514.5±30.0 °C at 760 mmHg |
| Flash Point | 279.0±21.1 °C |
| Exact Mass | 240.042252 |
| PSA | 74.60000 |
| LogP | 3.98 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |