Home
Products
Corydaline
| Product Name | Corydaline |
| Price: | $131 / 20mg |
| Catalog No.: | CN01406 |
| CAS No.: | 518-69-4 |
| Molecular Formula: | C22H27NO4 |
| Molecular Weight: | 369.44 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The tubers of Corydalis ambigua |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2CCN3[C@@H](c2cc1OC)[C@@H](C)c1c(C3)c(OC)c(cc1)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Corydaline is an acetylcholinesterase inhibitor isolated from Corydalis yanhusuo. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 482.3±45.0 °C at 760 mmHg |
| Flash Point | 135.7±25.9 °C |
| Exact Mass | 369.194000 |
| PSA | 40.16000 |
| LogP | 4.19 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Storage condition | -20°C |