Home
Products
Shikonin
| Product Name | Shikonin |
| Price: | Inquiry |
| Catalog No.: | CN05912 |
| CAS No.: | 517-88-4 |
| Molecular Formula: | C16H16O5 |
| Molecular Weight: | 288.31 g/mol |
| Purity: | >=98% |
| Type of Compound: | Quinones |
| Physical Desc.: | Purple powder |
| Source: | The roots of Lithosperraum erythrorhizon Sieb. et Zucc. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CC[C@@H](C1=CC(=O)c2c(C1=O)c(O)ccc2O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Alkannin, found in Alkanna tinctoria, is used as a food coloring. Alkannin shows anticancer activity, arrests cell cycle, and induces apoptosis. Alkannin improves hepatic inflammation in a Rho-kinase pathway[1][2][3]. |
| In Vitro | Alkannin inhibits HCT-116 and SW-480 cells growth with IC50s of 2.38 and 4.53 µM, respectively[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 567.4±50.0 °C at 760 mmHg |
| Flash Point | 311.0±26.6 °C |
| Exact Mass | 288.099762 |
| PSA | 94.83000 |
| LogP | 4.35 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |