Home
Products
Dicentrine
| Product Name | Dicentrine |
| Price: | $219 / 10mg |
| Catalog No.: | CN01246 |
| CAS No.: | 517-66-8 |
| Molecular Formula: | C20H21NO4 |
| Molecular Weight: | 339.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Cryst. |
| Source: | The roots of Stephania delavayi Diels |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2c(cc1OC)C[C@H]1c3c2c2OCOc2cc3CCN1C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dicentrine is a natural product isolated from the plant Lindera megaphylla with antihypertensive effect. Dicentrine is an α1-adrenoceptor antagonist which has effective against human hyperplastic prostates[1]. |
| Target | α1-adrenoceptor[1] |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 480.7±45.0 °C at 760 mmHg |
| Flash Point | 142.7±25.9 °C |
| Exact Mass | 339.147064 |
| PSA | 40.16000 |
| LogP | 3.98 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |